C17H20FN3O3 — CID 91781314
2-(4-fluorophenoxy)-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]acetamide (PubChem CID 91781314) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 91781314 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]acetamide |
| SMILES | Cn1cc(C(NC(=O)COc2ccc(F)cc2)C2CC(O)C2)cn1 |
| InChI | InChI=1S/C17H20FN3O3/c1-21-9-12(8-19-21)17(11-6-14(22)7-11)20-16(23)10-24-15-4-2-13(18)3-5-15/h2-5,8-9,11,14,17,22H,6-7,10H2,1H3,(H,20,23) |
| InChIKey | HLRUHMJLSTUISD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |