About 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol
3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol (PubChem CID 91781426) has the molecular formula C14H18N4OS
and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol |
| PubChem CID | 91781426 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol |
| SMILES | Cc1nc(C2CC(O)C2)cc(N(C)Cc2nccs2)n1 |
| InChI | InChI=1S/C14H18N4OS/c1-9-16-12(10-5-11(19)6-10)7-13(17-9)18(2)8-14-15-3-4-20-14/h3-4,7,10-11,19H,5-6,8H2,1-2H3 |
| InChIKey | GDYUJMTVSCPXMO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol?
The IUPAC name of 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol (CID 91781426) is 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol.
What is the SMILES notation for 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol?
The canonical SMILES for 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol is Cc1nc(C2CC(O)C2)cc(N(C)Cc2nccs2)n1.
What is the InChIKey of 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol?
The InChIKey is GDYUJMTVSCPXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4OS/c1-9-16-12(10-5-11(19)6-10)7-13(17-9)18(2)8-14-15-3-4-20-14/h3-4,7,10-11,19H,5-6,8H2,1-2H3.
What are the key properties of 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol?
3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol has a molecular weight of 290.39 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methyl-6-[methyl(1,3-thiazol-2-ylmethyl)amino]pyrimidin-4-yl]cyclobutan-1-ol is sourced from PubChem (CID 91781426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).