About 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol
2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol (PubChem CID 91781448) has the molecular formula C13H17F3N2O3
and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol |
| PubChem CID | 91781448 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol |
| SMILES | OCCO[C@H]1CCOC[C@H]1Nc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H17F3N2O3/c14-13(15,16)11-2-1-3-12(18-11)17-9-8-20-6-4-10(9)21-7-5-19/h1-3,9-10,19H,4-8H2,(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | PIRSKNZSNAGAIZ-ZJUUUORDSA-N |
| XLogP | 1.68 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol?
The IUPAC name of 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol (CID 91781448) is 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol.
What is the SMILES notation for 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol?
The canonical SMILES for 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol is OCCO[C@H]1CCOC[C@H]1Nc1cccc(C(F)(F)F)n1.
What is the InChIKey of 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol?
The InChIKey is PIRSKNZSNAGAIZ-ZJUUUORDSA-N. The full InChI is InChI=1S/C13H17F3N2O3/c14-13(15,16)11-2-1-3-12(18-11)17-9-8-20-6-4-10(9)21-7-5-19/h1-3,9-10,19H,4-8H2,(H,17,18)/t9-,10+/m1/s1.
What are the key properties of 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol?
2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol has a molecular weight of 306.28 g/mol, XLogP of 1.68, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-4-yl]oxyethanol is sourced from PubChem (CID 91781448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).