C18H24FN5O — CID 91781842
2-[3-(dimethylamino)pyrrolidin-1-yl]-N-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]acetamide (PubChem CID 91781842) has the molecular formula C18H24FN5O and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-[3-(dimethylamino)pyrrolidin-1-yl]-N-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]acetamide.
| Compound Name | 2-[3-(dimethylamino)pyrrolidin-1-yl]-N-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 91781842 |
| Molecular Formula | C18H24FN5O |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 2-[3-(dimethylamino)pyrrolidin-1-yl]-N-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]acetamide |
| SMILES | CN(C)C1CCN(CC(=O)NCc2cnn(-c3cccc(F)c3)c2)C1 |
| InChI | InChI=1S/C18H24FN5O/c1-22(2)17-6-7-23(12-17)13-18(25)20-9-14-10-21-24(11-14)16-5-3-4-15(19)8-16/h3-5,8,10-11,17H,6-7,9,12-13H2,1-2H3,(H,20,25) |
| InChIKey | QVQDCPKLBJLHBG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |