C18H21N3O4 — CID 91782322
N-[(1R,5S,6R,7R)-7-benzyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 91782322) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[(1R,5S,6R,7R)-7-benzyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[(1R,5S,6R,7R)-7-benzyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 91782322 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[(1R,5S,6R,7R)-7-benzyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)CNC1=O)N[C@@H]1[C@@H](Cc2ccccc2)[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C18H21N3O4/c22-14(10-21-15(23)9-19-18(21)24)20-16-12-6-7-25-17(12)13(16)8-11-4-2-1-3-5-11/h1-5,12-13,16-17H,6-10H2,(H,19,24)(H,20,22)/t12-,13+,16-,17-/m0/s1 |
| InChIKey | HIAUMBNARVFPTJ-RMHZUWNSSA-N |
| XLogP | 0.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|