C19H18N4O2 — CID 91782979
N-[(3-hydroxycyclobutyl)-quinolin-3-ylmethyl]pyridazine-4-carboxamide (PubChem CID 91782979) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)-quinolin-3-ylmethyl]pyridazine-4-carboxamide.
| Compound Name | N-[(3-hydroxycyclobutyl)-quinolin-3-ylmethyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 91782979 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)-quinolin-3-ylmethyl]pyridazine-4-carboxamide |
| SMILES | O=C(NC(c1cnc2ccccc2c1)C1CC(O)C1)c1ccnnc1 |
| InChI | InChI=1S/C19H18N4O2/c24-16-8-14(9-16)18(23-19(25)13-5-6-21-22-11-13)15-7-12-3-1-2-4-17(12)20-10-15/h1-7,10-11,14,16,18,24H,8-9H2,(H,23,25) |
| InChIKey | KJHQUDMOTQXYDH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |