C17H23N5O2 — CID 91783364
[2-(1-hydroxypropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-[2-(methylamino)-4-pyridinyl]methanone (PubChem CID 91783364) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is [2-(1-hydroxypropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-[2-(methylamino)-4-pyridinyl]methanone.
| Compound Name | [2-(1-hydroxypropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-[2-(methylamino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 91783364 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | [2-(1-hydroxypropyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-[2-(methylamino)-4-pyridinyl]methanone |
| SMILES | CCC(O)c1cc2n(n1)CCCN(C(=O)c1ccnc(NC)c1)C2 |
| InChI | InChI=1S/C17H23N5O2/c1-3-15(23)14-10-13-11-21(7-4-8-22(13)20-14)17(24)12-5-6-19-16(9-12)18-2/h5-6,9-10,15,23H,3-4,7-8,11H2,1-2H3,(H,18,19) |
| InChIKey | TZVUMNJYRJFRKL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |