C14H18Cl2N2O2 — CID 91783951
2,6-dichloro-N-[(3S,4S)-4-ethoxy-1-methylpyrrolidin-3-yl]benzamide (PubChem CID 91783951) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2,6-dichloro-N-[(3S,4S)-4-ethoxy-1-methylpyrrolidin-3-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[(3S,4S)-4-ethoxy-1-methylpyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 91783951 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2,6-dichloro-N-[(3S,4S)-4-ethoxy-1-methylpyrrolidin-3-yl]benzamide |
| SMILES | CCO[C@H]1CN(C)C[C@@H]1NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-3-20-12-8-18(2)7-11(12)17-14(19)13-9(15)5-4-6-10(13)16/h4-6,11-12H,3,7-8H2,1-2H3,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | MKNQFULDXRMZPN-RYUDHWBXSA-N |
| XLogP | 2.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |