C13H17F4N3O2 — CID 91784435
N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 91784435) has the molecular formula C13H17F4N3O2 and a molecular weight of 323.29 g/mol. Its IUPAC name is N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 91784435 |
| Molecular Formula | C13H17F4N3O2 |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | Cc1cc(C)nc(CCNC(=O)COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C13H17F4N3O2/c1-8-5-9(2)20-10(19-8)3-4-18-11(21)6-22-7-13(16,17)12(14)15/h5,12H,3-4,6-7H2,1-2H3,(H,18,21) |
| InChIKey | XSMRTUKTQRHKCQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|