About 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid
2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid (PubChem CID 91785162) has the molecular formula C14H19N3O6
and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid |
| PubChem CID | 91785162 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid |
| SMILES | Cc1ncc(CC(=O)N[C@@H]2COCC[C@@H]2OCC(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C14H19N3O6/c1-8-15-5-9(14(21)16-8)4-12(18)17-10-6-22-3-2-11(10)23-7-13(19)20/h5,10-11H,2-4,6-7H2,1H3,(H,17,18)(H,19,20)(H,15,16,21)/t10-,11+/m1/s1 |
| InChIKey | JWXXFUPODNYNGL-MNOVXSKESA-N |
| XLogP | -1.00 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid?
The IUPAC name of 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid (CID 91785162) is 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid.
What is the SMILES notation for 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid?
The canonical SMILES for 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid is Cc1ncc(CC(=O)N[C@@H]2COCC[C@@H]2OCC(=O)O)c(=O)[nH]1.
What is the InChIKey of 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid?
The InChIKey is JWXXFUPODNYNGL-MNOVXSKESA-N. The full InChI is InChI=1S/C14H19N3O6/c1-8-15-5-9(14(21)16-8)4-12(18)17-10-6-22-3-2-11(10)23-7-13(19)20/h5,10-11H,2-4,6-7H2,1H3,(H,17,18)(H,19,20)(H,15,16,21)/t10-,11+/m1/s1.
What are the key properties of 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid?
2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid has a molecular weight of 325.32 g/mol, XLogP of -1.00, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-3-[[2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetyl]amino]oxan-4-yl]oxyacetic acid is sourced from PubChem (CID 91785162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).