C19H17N3O3 — CID 91785242
N-(2,3-dihydro-1H-inden-2-yl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 91785242) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 91785242 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | CN(C(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C19H17N3O3/c1-22(14-8-11-4-2-3-5-12(11)9-14)19(25)13-6-7-15-16(10-13)21-18(24)17(23)20-15/h2-7,10,14H,8-9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | MJHNHIPFYVUTFV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|