About N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide
N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide (PubChem CID 9178578) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide |
| PubChem CID | 9178578 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide |
| SMILES | CCCCN1C(=O)[C@H](NC(C)=O)c2c(C)ccc(C)c21 |
| InChI | InChI=1S/C16H22N2O2/c1-5-6-9-18-15-11(3)8-7-10(2)13(15)14(16(18)20)17-12(4)19/h7-8,14H,5-6,9H2,1-4H3,(H,17,19)/t14-/m1/s1 |
| InChIKey | JUWARGPFOUYGHK-CQSZACIVSA-N |
| XLogP | 2.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide?
The IUPAC name of N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide (CID 9178578) is N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide.
What is the SMILES notation for N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide?
The canonical SMILES for N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide is CCCCN1C(=O)[C@H](NC(C)=O)c2c(C)ccc(C)c21.
What is the InChIKey of N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide?
The InChIKey is JUWARGPFOUYGHK-CQSZACIVSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-5-6-9-18-15-11(3)8-7-10(2)13(15)14(16(18)20)17-12(4)19/h7-8,14H,5-6,9H2,1-4H3,(H,17,19)/t14-/m1/s1.
What are the key properties of N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide?
N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide has a molecular weight of 274.36 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-1-butyl-4,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide is sourced from PubChem (CID 9178578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).