C18H27N3O3S — CID 91786157
N-methyl-4-[3-oxo-3-(3-piperidin-1-ylazetidin-1-yl)propyl]benzenesulfonamide (PubChem CID 91786157) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-methyl-4-[3-oxo-3-(3-piperidin-1-ylazetidin-1-yl)propyl]benzenesulfonamide.
| Compound Name | N-methyl-4-[3-oxo-3-(3-piperidin-1-ylazetidin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91786157 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-methyl-4-[3-oxo-3-(3-piperidin-1-ylazetidin-1-yl)propyl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)N2CC(N3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C18H27N3O3S/c1-19-25(23,24)17-8-5-15(6-9-17)7-10-18(22)21-13-16(14-21)20-11-3-2-4-12-20/h5-6,8-9,16,19H,2-4,7,10-14H2,1H3 |
| InChIKey | OCBXPQNKRQFBMX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |