C18H24N4O3 — CID 91786458
N-[3-[5-(hydroxymethyl)-4-methyl-1,2,4-triazol-3-yl]cyclobutyl]-4-phenoxybutanamide (PubChem CID 91786458) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[3-[5-(hydroxymethyl)-4-methyl-1,2,4-triazol-3-yl]cyclobutyl]-4-phenoxybutanamide.
| Compound Name | N-[3-[5-(hydroxymethyl)-4-methyl-1,2,4-triazol-3-yl]cyclobutyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 91786458 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[3-[5-(hydroxymethyl)-4-methyl-1,2,4-triazol-3-yl]cyclobutyl]-4-phenoxybutanamide |
| SMILES | Cn1c(CO)nnc1C1CC(NC(=O)CCCOc2ccccc2)C1 |
| InChI | InChI=1S/C18H24N4O3/c1-22-16(12-23)20-21-18(22)13-10-14(11-13)19-17(24)8-5-9-25-15-6-3-2-4-7-15/h2-4,6-7,13-14,23H,5,8-12H2,1H3,(H,19,24) |
| InChIKey | FIOJECXFYVTQSK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|