C17H23NO5S — CID 91786689
N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxamide (PubChem CID 91786689) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxamide.
| Compound Name | N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxamide |
|---|---|
| PubChem CID | 91786689 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[(3S,4R)-3-(3-methylbut-2-enoxy)oxan-4-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxamide |
| SMILES | CC(C)=CCO[C@@H]1COCC[C@H]1NC(=O)c1scc2c1OCCO2 |
| InChI | InChI=1S/C17H23NO5S/c1-11(2)3-6-21-13-9-20-5-4-12(13)18-17(19)16-15-14(10-24-16)22-7-8-23-15/h3,10,12-13H,4-9H2,1-2H3,(H,18,19)/t12-,13-/m1/s1 |
| InChIKey | CJINUZZMWAKUGG-CHWSQXEVSA-N |
| XLogP | 2.39 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|