About 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide
4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide (PubChem CID 91788011) has the molecular formula C18H19N3O4S
and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide |
| PubChem CID | 91788011 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N[C@@H]2COCC[C@H]2OCc2ccccn2)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c19-11-14-4-6-16(7-5-14)26(22,23)21-17-13-24-10-8-18(17)25-12-15-3-1-2-9-20-15/h1-7,9,17-18,21H,8,10,12-13H2/t17-,18-/m1/s1 |
| InChIKey | SEDKNJYJIDMAOB-QZTJIDSGSA-N |
| XLogP | 1.61 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide?
The IUPAC name of 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide (CID 91788011) is 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide.
What is the SMILES notation for 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide?
The canonical SMILES for 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide is N#Cc1ccc(S(=O)(=O)N[C@@H]2COCC[C@H]2OCc2ccccn2)cc1.
What is the InChIKey of 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide?
The InChIKey is SEDKNJYJIDMAOB-QZTJIDSGSA-N. The full InChI is InChI=1S/C18H19N3O4S/c19-11-14-4-6-16(7-5-14)26(22,23)21-17-13-24-10-8-18(17)25-12-15-3-1-2-9-20-15/h1-7,9,17-18,21H,8,10,12-13H2/t17-,18-/m1/s1.
What are the key properties of 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide?
4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide has a molecular weight of 373.43 g/mol, XLogP of 1.61, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide is sourced from PubChem (CID 91788011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).