C18H19N3O4S — CID 91788011
4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide (PubChem CID 91788011) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 91788011 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-cyano-N-[(3R,4R)-4-(pyridin-2-ylmethoxy)oxan-3-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N[C@@H]2COCC[C@H]2OCc2ccccn2)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c19-11-14-4-6-16(7-5-14)26(22,23)21-17-13-24-10-8-18(17)25-12-15-3-1-2-9-20-15/h1-7,9,17-18,21H,8,10,12-13H2/t17-,18-/m1/s1 |
| InChIKey | SEDKNJYJIDMAOB-QZTJIDSGSA-N |
| XLogP | 1.61 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |