C14H14F4N2O2 — CID 91788242
N-(1H-indol-6-ylmethyl)-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 91788242) has the molecular formula C14H14F4N2O2 and a molecular weight of 318.27 g/mol. Its IUPAC name is N-(1H-indol-6-ylmethyl)-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-(1H-indol-6-ylmethyl)-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 91788242 |
| Molecular Formula | C14H14F4N2O2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-(1H-indol-6-ylmethyl)-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | O=C(COCC(F)(F)C(F)F)NCc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C14H14F4N2O2/c15-13(16)14(17,18)8-22-7-12(21)20-6-9-1-2-10-3-4-19-11(10)5-9/h1-5,13,19H,6-8H2,(H,20,21) |
| InChIKey | NHXIXDNYTNKZIR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|