About 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide
1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide (PubChem CID 91788360) has the molecular formula C15H20N4O4S
and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide |
| PubChem CID | 91788360 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)N[C@@H]2CCOC[C@H]2OCc2ccccn2)cn1 |
| InChI | InChI=1S/C15H20N4O4S/c1-19-9-13(8-17-19)24(20,21)18-14-5-7-22-11-15(14)23-10-12-4-2-3-6-16-12/h2-4,6,8-9,14-15,18H,5,7,10-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | QGVQNPVCUXSIAY-HUUCEWRRSA-N |
| XLogP | 0.47 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide?
The IUPAC name of 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide (CID 91788360) is 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide.
What is the SMILES notation for 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide?
The canonical SMILES for 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide is Cn1cc(S(=O)(=O)N[C@@H]2CCOC[C@H]2OCc2ccccn2)cn1.
What is the InChIKey of 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide?
The InChIKey is QGVQNPVCUXSIAY-HUUCEWRRSA-N. The full InChI is InChI=1S/C15H20N4O4S/c1-19-9-13(8-17-19)24(20,21)18-14-5-7-22-11-15(14)23-10-12-4-2-3-6-16-12/h2-4,6,8-9,14-15,18H,5,7,10-11H2,1H3/t14-,15-/m1/s1.
What are the key properties of 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide?
1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide has a molecular weight of 352.42 g/mol, XLogP of 0.47, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazole-4-sulfonamide is sourced from PubChem (CID 91788360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).