About N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide
N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 91788386) has the molecular formula C14H18N2O3S
and a molecular weight of 294.38 g/mol. Its IUPAC name is N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide.
Molecular Properties
| Compound Name | N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide |
| PubChem CID | 91788386 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | COCc1nc(C)c(CNC(=O)c2cc(C)oc2C)s1 |
| InChI | InChI=1S/C14H18N2O3S/c1-8-5-11(10(3)19-8)14(17)15-6-12-9(2)16-13(20-12)7-18-4/h5H,6-7H2,1-4H3,(H,15,17) |
| InChIKey | QQWNUAHMENUKPF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide?
The IUPAC name of N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide (CID 91788386) is N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide.
What is the SMILES notation for N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide?
The canonical SMILES for N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide is COCc1nc(C)c(CNC(=O)c2cc(C)oc2C)s1.
What is the InChIKey of N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide?
The InChIKey is QQWNUAHMENUKPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3S/c1-8-5-11(10(3)19-8)14(17)15-6-12-9(2)16-13(20-12)7-18-4/h5H,6-7H2,1-4H3,(H,15,17).
What are the key properties of N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide?
N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide has a molecular weight of 294.38 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(methoxymethyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2,5-dimethylfuran-3-carboxamide is sourced from PubChem (CID 91788386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).