About 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol
3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol (PubChem CID 91788663) has the molecular formula C19H24N4O2
and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol |
| PubChem CID | 91788663 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol |
| SMILES | Cc1cccc(C)c1OC1CN(c2cc(C3CC(O)C3)nc(N)n2)C1 |
| InChI | InChI=1S/C19H24N4O2/c1-11-4-3-5-12(2)18(11)25-15-9-23(10-15)17-8-16(21-19(20)22-17)13-6-14(24)7-13/h3-5,8,13-15,24H,6-7,9-10H2,1-2H3,(H2,20,21,22) |
| InChIKey | YXRXJXWOEYEUBC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol?
The IUPAC name of 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol (CID 91788663) is 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol.
What is the SMILES notation for 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol?
The canonical SMILES for 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol is Cc1cccc(C)c1OC1CN(c2cc(C3CC(O)C3)nc(N)n2)C1.
What is the InChIKey of 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol?
The InChIKey is YXRXJXWOEYEUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O2/c1-11-4-3-5-12(2)18(11)25-15-9-23(10-15)17-8-16(21-19(20)22-17)13-6-14(24)7-13/h3-5,8,13-15,24H,6-7,9-10H2,1-2H3,(H2,20,21,22).
What are the key properties of 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol?
3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol has a molecular weight of 340.43 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-amino-6-[3-(2,6-dimethylphenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutan-1-ol is sourced from PubChem (CID 91788663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).