C12H13F4N3O2S — CID 91788850
N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 91788850) has the molecular formula C12H13F4N3O2S and a molecular weight of 339.31 g/mol. Its IUPAC name is N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 91788850 |
| Molecular Formula | C12H13F4N3O2S |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | Cc1csc2nc(CNC(=O)COCC(F)(F)C(F)F)cn12 |
| InChI | InChI=1S/C12H13F4N3O2S/c1-7-5-22-11-18-8(3-19(7)11)2-17-9(20)4-21-6-12(15,16)10(13)14/h3,5,10H,2,4,6H2,1H3,(H,17,20) |
| InChIKey | NAXYHPJHWXKRRZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|