C12H10ClN3O2 — CID 9178925
N-[(3R)-5-chloro-1-(cyanomethyl)-2-oxo-3H-indol-3-yl]acetamide (PubChem CID 9178925) has the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. Its IUPAC name is N-[(3R)-5-chloro-1-(cyanomethyl)-2-oxo-3H-indol-3-yl]acetamide.
| Compound Name | N-[(3R)-5-chloro-1-(cyanomethyl)-2-oxo-3H-indol-3-yl]acetamide |
|---|---|
| PubChem CID | 9178925 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | N-[(3R)-5-chloro-1-(cyanomethyl)-2-oxo-3H-indol-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(=O)N(CC#N)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H10ClN3O2/c1-7(17)15-11-9-6-8(13)2-3-10(9)16(5-4-14)12(11)18/h2-3,6,11H,5H2,1H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | KYXIIVXPCYSXIW-LLVKDONJSA-N |
| XLogP | 1.39 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|