About 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one
1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one (PubChem CID 91789263) has the molecular formula C15H22N8O
and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one |
| PubChem CID | 91789263 |
| Molecular Formula | C15H22N8O |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one |
| SMILES | Cc1cnc(C)c(N2CCN(C(=O)CCn3nnnc3C)CC2)n1 |
| InChI | InChI=1S/C15H22N8O/c1-11-10-16-12(2)15(17-11)22-8-6-21(7-9-22)14(24)4-5-23-13(3)18-19-20-23/h10H,4-9H2,1-3H3 |
| InChIKey | MHPQZZJALUJZDT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 92.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one?
The IUPAC name of 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one (CID 91789263) is 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one.
What is the SMILES notation for 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one?
The canonical SMILES for 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one is Cc1cnc(C)c(N2CCN(C(=O)CCn3nnnc3C)CC2)n1.
What is the InChIKey of 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one?
The InChIKey is MHPQZZJALUJZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N8O/c1-11-10-16-12(2)15(17-11)22-8-6-21(7-9-22)14(24)4-5-23-13(3)18-19-20-23/h10H,4-9H2,1-3H3.
What are the key properties of 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one?
1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one has a molecular weight of 330.40 g/mol, XLogP of 0.13, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,6-dimethylpyrazin-2-yl)piperazin-1-yl]-3-(5-methyltetrazol-1-yl)propan-1-one is sourced from PubChem (CID 91789263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).