C19H25NO3 — CID 91789520
N-[(2-hydroxy-2-adamantyl)methyl]-2-(3-hydroxyphenyl)acetamide (PubChem CID 91789520) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-[(2-hydroxy-2-adamantyl)methyl]-2-(3-hydroxyphenyl)acetamide.
| Compound Name | N-[(2-hydroxy-2-adamantyl)methyl]-2-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 91789520 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-[(2-hydroxy-2-adamantyl)methyl]-2-(3-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1cccc(O)c1)NCC1(O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H25NO3/c21-17-3-1-2-12(9-17)10-18(22)20-11-19(23)15-5-13-4-14(7-15)8-16(19)6-13/h1-3,9,13-16,21,23H,4-8,10-11H2,(H,20,22) |
| InChIKey | AWSKZTGSLULIAF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |