C12H17N3O — CID 91790243
(5-pent-2-ynyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)methanol (PubChem CID 91790243) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is (5-pent-2-ynyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)methanol.
| Compound Name | (5-pent-2-ynyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 91790243 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (5-pent-2-ynyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)methanol |
| SMILES | CCC#CCN1CCn2nc(CO)cc2C1 |
| InChI | InChI=1S/C12H17N3O/c1-2-3-4-5-14-6-7-15-12(9-14)8-11(10-16)13-15/h8,16H,2,5-7,9-10H2,1H3 |
| InChIKey | MCZXIEKYLRPQBK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|