About 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide
4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide (PubChem CID 91790464) has the molecular formula C17H19FN2O4S
and a molecular weight of 366.41 g/mol. Its IUPAC name is 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide |
| PubChem CID | 91790464 |
| Molecular Formula | C17H19FN2O4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCOC[C@H]1OCc1ccccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN2O4S/c18-13-4-6-15(7-5-13)25(21,22)20-16-8-10-23-12-17(16)24-11-14-3-1-2-9-19-14/h1-7,9,16-17,20H,8,10-12H2/t16-,17-/m1/s1 |
| InChIKey | LLFBMLAUANAYAJ-IAGOWNOFSA-N |
| XLogP | 1.87 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide?
The IUPAC name of 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide (CID 91790464) is 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide.
What is the SMILES notation for 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide?
The canonical SMILES for 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide is O=S(=O)(N[C@@H]1CCOC[C@H]1OCc1ccccn1)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide?
The InChIKey is LLFBMLAUANAYAJ-IAGOWNOFSA-N. The full InChI is InChI=1S/C17H19FN2O4S/c18-13-4-6-15(7-5-13)25(21,22)20-16-8-10-23-12-17(16)24-11-14-3-1-2-9-19-14/h1-7,9,16-17,20H,8,10-12H2/t16-,17-/m1/s1.
What are the key properties of 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide?
4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide has a molecular weight of 366.41 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]benzenesulfonamide is sourced from PubChem (CID 91790464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).