C19H24FN5O — CID 91791199
4-(3-aminocyclobutyl)-6-[4-(3-fluorophenoxy)piperidin-1-yl]pyrimidin-2-amine (PubChem CID 91791199) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-(3-aminocyclobutyl)-6-[4-(3-fluorophenoxy)piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-(3-aminocyclobutyl)-6-[4-(3-fluorophenoxy)piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 91791199 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 4-(3-aminocyclobutyl)-6-[4-(3-fluorophenoxy)piperidin-1-yl]pyrimidin-2-amine |
| SMILES | Nc1nc(C2CC(N)C2)cc(N2CCC(Oc3cccc(F)c3)CC2)n1 |
| InChI | InChI=1S/C19H24FN5O/c20-13-2-1-3-16(10-13)26-15-4-6-25(7-5-15)18-11-17(23-19(22)24-18)12-8-14(21)9-12/h1-3,10-12,14-15H,4-9,21H2,(H2,22,23,24) |
| InChIKey | NZGDDALGCOEVLA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |