C19H31N5O2 — CID 91791504
N-[(1-cyclopentylpiperidin-4-yl)methyl]-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 91791504) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[(1-cyclopentylpiperidin-4-yl)methyl]-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 91791504 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | Cn1nc2n(c1=O)CC(C(=O)NCC1CCN(C3CCCC3)CC1)CC2 |
| InChI | InChI=1S/C19H31N5O2/c1-22-19(26)24-13-15(6-7-17(24)21-22)18(25)20-12-14-8-10-23(11-9-14)16-4-2-3-5-16/h14-16H,2-13H2,1H3,(H,20,25) |
| InChIKey | WJKZXPDUELBVSI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |