C13H16N4OS — CID 91791541
N-[1-(5-methyl-1H-imidazol-2-yl)ethyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 91791541) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is N-[1-(5-methyl-1H-imidazol-2-yl)ethyl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[1-(5-methyl-1H-imidazol-2-yl)ethyl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 91791541 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-[1-(5-methyl-1H-imidazol-2-yl)ethyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)NC(C)c1ncc(C)[nH]1 |
| InChI | InChI=1S/C13H16N4OS/c1-8-7-15-11(16-8)9(2)17-12(18)10-5-4-6-14-13(10)19-3/h4-7,9H,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | OKHRYSBZRZGEPX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |