C17H30N4O — CID 91791648
[1-[(1-ethylimidazol-2-yl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol (PubChem CID 91791648) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is [1-[(1-ethylimidazol-2-yl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol.
| Compound Name | [1-[(1-ethylimidazol-2-yl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 91791648 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | [1-[(1-ethylimidazol-2-yl)methyl]-4-(pyrrolidin-1-ylmethyl)piperidin-4-yl]methanol |
| SMILES | CCn1ccnc1CN1CCC(CO)(CN2CCCC2)CC1 |
| InChI | InChI=1S/C17H30N4O/c1-2-21-12-7-18-16(21)13-19-10-5-17(15-22,6-11-19)14-20-8-3-4-9-20/h7,12,22H,2-6,8-11,13-15H2,1H3 |
| InChIKey | NONNAYACRRIKJI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |