C16H21F2NO4 — CID 91791837
2-(difluoromethoxy)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-N-methylbenzamide (PubChem CID 91791837) has the molecular formula C16H21F2NO4 and a molecular weight of 329.34 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-N-methylbenzamide.
| Compound Name | 2-(difluoromethoxy)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 91791837 |
| Molecular Formula | C16H21F2NO4 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-(difluoromethoxy)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]-N-methylbenzamide |
| SMILES | CN(CC1(CO)CCOCC1)C(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H21F2NO4/c1-19(10-16(11-20)6-8-22-9-7-16)14(21)12-4-2-3-5-13(12)23-15(17)18/h2-5,15,20H,6-11H2,1H3 |
| InChIKey | YANYQESIPXIMGE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |