C16H21N3O2 — CID 91792073
N-(1,3-benzoxazol-2-ylmethyl)-2-(3-methylpiperidin-1-yl)acetamide (PubChem CID 91792073) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-(1,3-benzoxazol-2-ylmethyl)-2-(3-methylpiperidin-1-yl)acetamide.
| Compound Name | N-(1,3-benzoxazol-2-ylmethyl)-2-(3-methylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 91792073 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-(1,3-benzoxazol-2-ylmethyl)-2-(3-methylpiperidin-1-yl)acetamide |
| SMILES | CC1CCCN(CC(=O)NCc2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C16H21N3O2/c1-12-5-4-8-19(10-12)11-15(20)17-9-16-18-13-6-2-3-7-14(13)21-16/h2-3,6-7,12H,4-5,8-11H2,1H3,(H,17,20) |
| InChIKey | DHZIEJNHCIFERE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |