C23H30N2O2 — CID 91792475
1-[4-(hydroxymethyl)-4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]-2-naphthalen-2-ylethanone (PubChem CID 91792475) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)-4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]-2-naphthalen-2-ylethanone.
| Compound Name | 1-[4-(hydroxymethyl)-4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]-2-naphthalen-2-ylethanone |
|---|---|
| PubChem CID | 91792475 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[4-(hydroxymethyl)-4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]-2-naphthalen-2-ylethanone |
| SMILES | O=C(Cc1ccc2ccccc2c1)N1CCC(CO)(CN2CCCC2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c26-18-23(17-24-11-3-4-12-24)9-13-25(14-10-23)22(27)16-19-7-8-20-5-1-2-6-21(20)15-19/h1-2,5-8,15,26H,3-4,9-14,16-18H2 |
| InChIKey | KLCAOGMDOMJHAQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |