C16H20N4O5S — CID 91792762
N-[(1R,5R,6S,7R)-6-[(5,7-dimethyl-2,1,3-benzoxadiazol-4-yl)sulfonylamino]-2-oxabicyclo[3.2.0]heptan-7-yl]acetamide (PubChem CID 91792762) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[(1R,5R,6S,7R)-6-[(5,7-dimethyl-2,1,3-benzoxadiazol-4-yl)sulfonylamino]-2-oxabicyclo[3.2.0]heptan-7-yl]acetamide.
| Compound Name | N-[(1R,5R,6S,7R)-6-[(5,7-dimethyl-2,1,3-benzoxadiazol-4-yl)sulfonylamino]-2-oxabicyclo[3.2.0]heptan-7-yl]acetamide |
|---|---|
| PubChem CID | 91792762 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[(1R,5R,6S,7R)-6-[(5,7-dimethyl-2,1,3-benzoxadiazol-4-yl)sulfonylamino]-2-oxabicyclo[3.2.0]heptan-7-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](NS(=O)(=O)c2c(C)cc(C)c3nonc23)[C@H]2CCO[C@H]21 |
| InChI | InChI=1S/C16H20N4O5S/c1-7-6-8(2)16(14-11(7)18-25-19-14)26(22,23)20-12-10-4-5-24-15(10)13(12)17-9(3)21/h6,10,12-13,15,20H,4-5H2,1-3H3,(H,17,21)/t10-,12+,13-,15-/m1/s1 |
| InChIKey | QTHOVMVFQQRLAN-CQROYNQRSA-N |
| XLogP | 0.41 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |