About 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol
3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol (PubChem CID 91792889) has the molecular formula C14H19N5O
and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol |
| PubChem CID | 91792889 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol |
| SMILES | Cc1n[nH]c(C)c1CNc1cc(C2CC(O)C2)ncn1 |
| InChI | InChI=1S/C14H19N5O/c1-8-12(9(2)19-18-8)6-15-14-5-13(16-7-17-14)10-3-11(20)4-10/h5,7,10-11,20H,3-4,6H2,1-2H3,(H,18,19)(H,15,16,17) |
| InChIKey | PJUOMSZWRRRYAW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol?
The IUPAC name of 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol (CID 91792889) is 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol.
What is the SMILES notation for 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol?
The canonical SMILES for 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol is Cc1n[nH]c(C)c1CNc1cc(C2CC(O)C2)ncn1.
What is the InChIKey of 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol?
The InChIKey is PJUOMSZWRRRYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O/c1-8-12(9(2)19-18-8)6-15-14-5-13(16-7-17-14)10-3-11(20)4-10/h5,7,10-11,20H,3-4,6H2,1-2H3,(H,18,19)(H,15,16,17).
What are the key properties of 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol?
3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol has a molecular weight of 273.34 g/mol, XLogP of 1.67, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol is sourced from PubChem (CID 91792889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).