C20H32N4O2 — CID 91793143
(2S)-1-[[4-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 91793143) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2S)-1-[[4-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[[4-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91793143 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (2S)-1-[[4-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CCN1CCN(CCOc2ccc(CN3CCC[C@H]3C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C20H32N4O2/c1-2-22-10-12-23(13-11-22)14-15-26-18-7-5-17(6-8-18)16-24-9-3-4-19(24)20(21)25/h5-8,19H,2-4,9-16H2,1H3,(H2,21,25)/t19-/m0/s1 |
| InChIKey | UKOKSNIEHYPJIP-IBGZPJMESA-N |
| XLogP | 1.15 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |