About N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide (PubChem CID 91793352) has the molecular formula C13H19N5OS
and a molecular weight of 293.40 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide |
| PubChem CID | 91793352 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide |
| SMILES | CCc1nccn1CC(=O)NCCCc1csc(N)n1 |
| InChI | InChI=1S/C13H19N5OS/c1-2-11-15-6-7-18(11)8-12(19)16-5-3-4-10-9-20-13(14)17-10/h6-7,9H,2-5,8H2,1H3,(H2,14,17)(H,16,19) |
| InChIKey | QCUYQTFGDQYIGP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide?
The IUPAC name of N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide (CID 91793352) is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide.
What is the SMILES notation for N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide?
The canonical SMILES for N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide is CCc1nccn1CC(=O)NCCCc1csc(N)n1.
What is the InChIKey of N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide?
The InChIKey is QCUYQTFGDQYIGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5OS/c1-2-11-15-6-7-18(11)8-12(19)16-5-3-4-10-9-20-13(14)17-10/h6-7,9H,2-5,8H2,1H3,(H2,14,17)(H,16,19).
What are the key properties of N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide?
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide has a molecular weight of 293.40 g/mol, XLogP of 1.23, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(2-ethylimidazol-1-yl)acetamide is sourced from PubChem (CID 91793352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).