C19H28N6O — CID 91793806
3-[4-cyclopropyl-5-[(4,4,6,6-tetramethylfuro[3,4-d]pyrazol-1-yl)methyl]-1,2,4-triazol-3-yl]cyclobutan-1-amine (PubChem CID 91793806) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-[4-cyclopropyl-5-[(4,4,6,6-tetramethylfuro[3,4-d]pyrazol-1-yl)methyl]-1,2,4-triazol-3-yl]cyclobutan-1-amine.
| Compound Name | 3-[4-cyclopropyl-5-[(4,4,6,6-tetramethylfuro[3,4-d]pyrazol-1-yl)methyl]-1,2,4-triazol-3-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 91793806 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 3-[4-cyclopropyl-5-[(4,4,6,6-tetramethylfuro[3,4-d]pyrazol-1-yl)methyl]-1,2,4-triazol-3-yl]cyclobutan-1-amine |
| SMILES | CC1(C)OC(C)(C)c2c1cnn2Cc1nnc(C2CC(N)C2)n1C1CC1 |
| InChI | InChI=1S/C19H28N6O/c1-18(2)14-9-21-24(16(14)19(3,4)26-18)10-15-22-23-17(11-7-12(20)8-11)25(15)13-5-6-13/h9,11-13H,5-8,10,20H2,1-4H3 |
| InChIKey | MFQUARSPFDJNDE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |