C17H21N5O3 — CID 91794568
2-(5-amino-3-methylpyrazol-1-yl)-N-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]acetamide (PubChem CID 91794568) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-(5-amino-3-methylpyrazol-1-yl)-N-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]acetamide.
| Compound Name | 2-(5-amino-3-methylpyrazol-1-yl)-N-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 91794568 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-(5-amino-3-methylpyrazol-1-yl)-N-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]acetamide |
| SMILES | COc1cccc(N2CC(NC(=O)Cn3nc(C)cc3N)CC2=O)c1 |
| InChI | InChI=1S/C17H21N5O3/c1-11-6-15(18)22(20-11)10-16(23)19-12-7-17(24)21(9-12)13-4-3-5-14(8-13)25-2/h3-6,8,12H,7,9-10,18H2,1-2H3,(H,19,23) |
| InChIKey | SWRZEVAXAXUYDR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |