C19H21FN4O2 — CID 91795366
N-[3-[6-[3-(2-fluorophenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutyl]acetamide (PubChem CID 91795366) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is N-[3-[6-[3-(2-fluorophenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutyl]acetamide.
| Compound Name | N-[3-[6-[3-(2-fluorophenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutyl]acetamide |
|---|---|
| PubChem CID | 91795366 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[3-[6-[3-(2-fluorophenoxy)azetidin-1-yl]pyrimidin-4-yl]cyclobutyl]acetamide |
| SMILES | CC(=O)NC1CC(c2cc(N3CC(Oc4ccccc4F)C3)ncn2)C1 |
| InChI | InChI=1S/C19H21FN4O2/c1-12(25)23-14-6-13(7-14)17-8-19(22-11-21-17)24-9-15(10-24)26-18-5-3-2-4-16(18)20/h2-5,8,11,13-15H,6-7,9-10H2,1H3,(H,23,25) |
| InChIKey | HUHWZFLNZGIGNA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |