C16H19N7O3 — CID 91795452
[2-(1,2-dihydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-(7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methanone (PubChem CID 91795452) has the molecular formula C16H19N7O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is [2-(1,2-dihydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-(7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methanone.
| Compound Name | [2-(1,2-dihydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-(7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methanone |
|---|---|
| PubChem CID | 91795452 |
| Molecular Formula | C16H19N7O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [2-(1,2-dihydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-(7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methanone |
| SMILES | Cc1ccn2c(C(=O)N3CCCn4nc(C(O)CO)cc4C3)nnc2n1 |
| InChI | InChI=1S/C16H19N7O3/c1-10-3-6-22-14(18-19-16(22)17-10)15(26)21-4-2-5-23-11(8-21)7-12(20-23)13(25)9-24/h3,6-7,13,24-25H,2,4-5,8-9H2,1H3 |
| InChIKey | WYBGCYULGHTCAB-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |