About 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one
3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one (PubChem CID 91795693) has the molecular formula C17H19ClF2N2O2
and a molecular weight of 356.80 g/mol. Its IUPAC name is 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one.
Molecular Properties
| Compound Name | 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one |
| PubChem CID | 91795693 |
| Molecular Formula | C17H19ClF2N2O2 |
| Molecular Weight | 356.80 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one |
| SMILES | O=C1CCC2(CCN1)CCN(C(=O)c1cc(F)c(F)cc1Cl)CC2 |
| InChI | InChI=1S/C17H19ClF2N2O2/c18-12-10-14(20)13(19)9-11(12)16(24)22-7-4-17(5-8-22)2-1-15(23)21-6-3-17/h9-10H,1-8H2,(H,21,23) |
| InChIKey | CNEDDAIOWCLNAS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one?
The IUPAC name of 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one (CID 91795693) is 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one.
What is the SMILES notation for 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one?
The canonical SMILES for 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one is O=C1CCC2(CCN1)CCN(C(=O)c1cc(F)c(F)cc1Cl)CC2.
What is the InChIKey of 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one?
The InChIKey is CNEDDAIOWCLNAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClF2N2O2/c18-12-10-14(20)13(19)9-11(12)16(24)22-7-4-17(5-8-22)2-1-15(23)21-6-3-17/h9-10H,1-8H2,(H,21,23).
What are the key properties of 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one?
3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one has a molecular weight of 356.80 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-4,5-difluorobenzoyl)-3,10-diazaspiro[5.6]dodecan-9-one is sourced from PubChem (CID 91795693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).