C20H23N3O2 — CID 9179587
N-(4-methylphenyl)-N'-[(Z)-(3-methyl-1-phenylbutylidene)amino]oxamide (PubChem CID 9179587) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-(4-methylphenyl)-N'-[(Z)-(3-methyl-1-phenylbutylidene)amino]oxamide.
| Compound Name | N-(4-methylphenyl)-N'-[(Z)-(3-methyl-1-phenylbutylidene)amino]oxamide |
|---|---|
| PubChem CID | 9179587 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-(4-methylphenyl)-N'-[(Z)-(3-methyl-1-phenylbutylidene)amino]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C(/CC(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-14(2)13-18(16-7-5-4-6-8-16)22-23-20(25)19(24)21-17-11-9-15(3)10-12-17/h4-12,14H,13H2,1-3H3,(H,21,24)(H,23,25)/b22-18- |
| InChIKey | MKZLFEKPVOMCDM-PYCFMQQDSA-N |
| XLogP | 3.50 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|