C19H21NO6 — CID 91796230
4-[(3S,4R)-4-[(2,5-dimethylfuran-3-carbonyl)amino]oxan-3-yl]oxybenzoic acid (PubChem CID 91796230) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-[(3S,4R)-4-[(2,5-dimethylfuran-3-carbonyl)amino]oxan-3-yl]oxybenzoic acid.
| Compound Name | 4-[(3S,4R)-4-[(2,5-dimethylfuran-3-carbonyl)amino]oxan-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 91796230 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-[(3S,4R)-4-[(2,5-dimethylfuran-3-carbonyl)amino]oxan-3-yl]oxybenzoic acid |
| SMILES | Cc1cc(C(=O)N[C@@H]2CCOC[C@H]2Oc2ccc(C(=O)O)cc2)c(C)o1 |
| InChI | InChI=1S/C19H21NO6/c1-11-9-15(12(2)25-11)18(21)20-16-7-8-24-10-17(16)26-14-5-3-13(4-6-14)19(22)23/h3-6,9,16-17H,7-8,10H2,1-2H3,(H,20,21)(H,22,23)/t16-,17-/m1/s1 |
| InChIKey | WGPWBEKPFKUMDI-IAGOWNOFSA-N |
| XLogP | 2.56 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |