C14H17ClN4O3S — CID 91797066
N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-2-(methanesulfonamido)propanamide (PubChem CID 91797066) has the molecular formula C14H17ClN4O3S and a molecular weight of 356.84 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-2-(methanesulfonamido)propanamide.
| Compound Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-2-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 91797066 |
| Molecular Formula | C14H17ClN4O3S |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-2-(methanesulfonamido)propanamide |
| SMILES | CC(NS(C)(=O)=O)C(=O)NCc1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN4O3S/c1-9(19-23(2,21)22)14(20)16-7-11-8-17-18-13(11)10-3-5-12(15)6-4-10/h3-6,8-9,19H,7H2,1-2H3,(H,16,20)(H,17,18) |
| InChIKey | PUPHHDXEHYYGLD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |