C15H23FN4O — CID 91797711
3-[6-(4-fluoropiperidin-1-yl)-2-(methoxymethyl)pyrimidin-4-yl]cyclobutan-1-amine (PubChem CID 91797711) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is 3-[6-(4-fluoropiperidin-1-yl)-2-(methoxymethyl)pyrimidin-4-yl]cyclobutan-1-amine.
| Compound Name | 3-[6-(4-fluoropiperidin-1-yl)-2-(methoxymethyl)pyrimidin-4-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 91797711 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 3-[6-(4-fluoropiperidin-1-yl)-2-(methoxymethyl)pyrimidin-4-yl]cyclobutan-1-amine |
| SMILES | COCc1nc(C2CC(N)C2)cc(N2CCC(F)CC2)n1 |
| InChI | InChI=1S/C15H23FN4O/c1-21-9-14-18-13(10-6-12(17)7-10)8-15(19-14)20-4-2-11(16)3-5-20/h8,10-12H,2-7,9,17H2,1H3 |
| InChIKey | KXXIUINZZPCZHN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |