C18H18FN5OS — CID 9179789
2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N',N'-dimethylacetohydrazide (PubChem CID 9179789) has the molecular formula C18H18FN5OS and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N',N'-dimethylacetohydrazide.
| Compound Name | 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 9179789 |
| Molecular Formula | C18H18FN5OS |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N',N'-dimethylacetohydrazide |
| SMILES | CN(C)NC(=O)CSc1nnc(-c2ccccc2F)n1-c1ccccc1 |
| InChI | InChI=1S/C18H18FN5OS/c1-23(2)22-16(25)12-26-18-21-20-17(14-10-6-7-11-15(14)19)24(18)13-8-4-3-5-9-13/h3-11H,12H2,1-2H3,(H,22,25) |
| InChIKey | WPOKRHCWLORHME-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|