C17H27N5O2 — CID 91798019
(2-amino-6-propan-2-ylpyrimidin-4-yl)-[4-(oxan-4-yl)piperazin-1-yl]methanone (PubChem CID 91798019) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is (2-amino-6-propan-2-ylpyrimidin-4-yl)-[4-(oxan-4-yl)piperazin-1-yl]methanone.
| Compound Name | (2-amino-6-propan-2-ylpyrimidin-4-yl)-[4-(oxan-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 91798019 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | (2-amino-6-propan-2-ylpyrimidin-4-yl)-[4-(oxan-4-yl)piperazin-1-yl]methanone |
| SMILES | CC(C)c1cc(C(=O)N2CCN(C3CCOCC3)CC2)nc(N)n1 |
| InChI | InChI=1S/C17H27N5O2/c1-12(2)14-11-15(20-17(18)19-14)16(23)22-7-5-21(6-8-22)13-3-9-24-10-4-13/h11-13H,3-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | NVULQFWLSITIOI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |