C17H27N5O — CID 91798280
N-[3-[6-(methylamino)pyrimidin-4-yl]cyclobutyl]-2-(4-methylpiperidin-1-yl)acetamide (PubChem CID 91798280) has the molecular formula C17H27N5O and a molecular weight of 317.44 g/mol. Its IUPAC name is N-[3-[6-(methylamino)pyrimidin-4-yl]cyclobutyl]-2-(4-methylpiperidin-1-yl)acetamide.
| Compound Name | N-[3-[6-(methylamino)pyrimidin-4-yl]cyclobutyl]-2-(4-methylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 91798280 |
| Molecular Formula | C17H27N5O |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | N-[3-[6-(methylamino)pyrimidin-4-yl]cyclobutyl]-2-(4-methylpiperidin-1-yl)acetamide |
| SMILES | CNc1cc(C2CC(NC(=O)CN3CCC(C)CC3)C2)ncn1 |
| InChI | InChI=1S/C17H27N5O/c1-12-3-5-22(6-4-12)10-17(23)21-14-7-13(8-14)15-9-16(18-2)20-11-19-15/h9,11-14H,3-8,10H2,1-2H3,(H,21,23)(H,18,19,20) |
| InChIKey | GRRNLGPLANMZJS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |