About 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide
5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide (PubChem CID 91798306) has the molecular formula C17H20N2O4S
and a molecular weight of 348.42 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide |
| PubChem CID | 91798306 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide |
| SMILES | COCc1ccc(C(=O)N[C@@H]2COCC[C@H]2Oc2ccccn2)s1 |
| InChI | InChI=1S/C17H20N2O4S/c1-21-10-12-5-6-15(24-12)17(20)19-13-11-22-9-7-14(13)23-16-4-2-3-8-18-16/h2-6,8,13-14H,7,9-11H2,1H3,(H,19,20)/t13-,14-/m1/s1 |
| InChIKey | RNBPNNKGROZTEP-ZIAGYGMSSA-N |
| XLogP | 2.26 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide?
The IUPAC name of 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide (CID 91798306) is 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide.
What is the SMILES notation for 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide?
The canonical SMILES for 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide is COCc1ccc(C(=O)N[C@@H]2COCC[C@H]2Oc2ccccn2)s1.
What is the InChIKey of 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide?
The InChIKey is RNBPNNKGROZTEP-ZIAGYGMSSA-N. The full InChI is InChI=1S/C17H20N2O4S/c1-21-10-12-5-6-15(24-12)17(20)19-13-11-22-9-7-14(13)23-16-4-2-3-8-18-16/h2-6,8,13-14H,7,9-11H2,1H3,(H,19,20)/t13-,14-/m1/s1.
What are the key properties of 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide?
5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide has a molecular weight of 348.42 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide is sourced from PubChem (CID 91798306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).